Drugbox |Verifiedfields = changed |Watchedfields = changed |verifiedrevid = 458460406 |image = Ranitidine.svg |width = 250 |image2 = File:Ranitidine-A-3D-balls.png |JAN = ranitidine hydrochloride |tradename = Zantac, others |Drugs.com = |MedlinePlus = a601106 |licence_CA = |licence_EU = |DailyMedID = Ranitidine |licence_US = Ranitidine |pregnancy_AU = B1 |pregnancy_AU_comment = |routes_of_administration = By mouth, intravenous (IV) |class = Histamine H2 receptor antagonist, aka H2 blocker |ATC_prefix = A02 |ATC_suffix = BA02 |ATC_supplemental = (ranitidine bismuth citrate) |legal_AU = S4 |legal_AU_comment = / S2 (Pharmacy Medicine) |legal_BR = |legal_CA = |legal_DE = |legal_NZ = |legal_UK = POM |legal_UK_comment = / GSL (General sales list) |legal_US = Rx-only |legal_US_comment = / OTC |legal_EU = Rx-only |legal_UN = |bioavailability = 50% (by mouth) |protein_bound = 15% |metabolism = Liver: FMOs, including FMO3; other enzymes |onset = 55–65 minutes (150 mg dose)55–115 minutes (75 mg dose) |elimination_half-life = 2–3 hours |duration_of_action = |excretion = 30–70% kidney |index2_label = HCl |CAS_number_Ref = |CAS_number = 66357-35-5 |CAS_number2_Ref = |CAS_number2 = 66357-59-3 |PubChem = 3001055 |PubChem2 = 3033332 |IUPHAR_ligand = 1234 |DrugBank_Ref = |DrugBank = DB00863 |DrugBank2_Ref = |DrugBank2 = DBSALT000487 |ChemSpiderID_Ref = |ChemSpiderID = 4863 |ChemSpiderID2_Ref = |ChemSpiderID2 = 43590 |UNII_Ref = |UNII = 884KT10YB7 |UNII2_Ref = |UNII2 = BK76465IHM |KEGG_Ref = |KEGG = D00422 |KEGG2_Ref = |KEGG2 = D00673 |ChEBI_Ref = |ChEBI = 8776 |ChEBI2_Ref = |ChEBI2 = 8777 |ChEMBL_Ref = |ChEMBL = 1790041 |ChEMBL2_Ref = |ChEMBL2 = 2110372 |synonyms = Dimethyl [(5-{[(2-{[1-(methylamino)-2-nitroethenyl]amino}ethyl)sulfanyl]methyl}furan-2-yl)methyl]amine |IUPAC_name = N-(2-[(5-[(Dimethylamino)methyl]furan-2-yl)methylthio]ethyl)-''N-methyl-2-nitroethene-1,1-diamine |C = 13 | H = 22 | N = 4 | O = 3 | S = 1 |SMILES = CNC(=CN+[O-])NCCSCC1=CC=C(O1)CN(C)C |StdInChI_Ref = |StdInChI = 1S/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3 |StdInChIKey_Ref = |StdInChIKey = VMXUWOKSQNHOCA-UHFFFAOYSA-N Ranitidine, sold under the brand name Zantac among others, is a medication used to decrease stomach acid production.